C21H25NO2 — CID 82140137
3-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)propanenitrile (PubChem CID 82140137) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)propanenitrile.
| Compound Name | 3-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 82140137 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-(2,5-dimethoxyphenyl)propanenitrile |
| SMILES | COc1ccc(OC)c(C(C#N)Cc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H25NO2/c1-21(2,3)17-8-6-15(7-9-17)12-16(14-22)19-13-18(23-4)10-11-20(19)24-5/h6-11,13,16H,12H2,1-5H3 |
| InChIKey | IDZLQNKVHQPCRO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |