C18H15FN2O2 — CID 58258175
4-[2-cyano-2-(2-fluoro-3,5-dimethoxyphenyl)ethyl]benzonitrile (PubChem CID 58258175) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-[2-cyano-2-(2-fluoro-3,5-dimethoxyphenyl)ethyl]benzonitrile.
| Compound Name | 4-[2-cyano-2-(2-fluoro-3,5-dimethoxyphenyl)ethyl]benzonitrile |
|---|---|
| PubChem CID | 58258175 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[2-cyano-2-(2-fluoro-3,5-dimethoxyphenyl)ethyl]benzonitrile |
| SMILES | COc1cc(OC)c(F)c(C(C#N)Cc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C18H15FN2O2/c1-22-15-8-16(18(19)17(9-15)23-2)14(11-21)7-12-3-5-13(10-20)6-4-12/h3-6,8-9,14H,7H2,1-2H3 |
| InChIKey | KEWYVAYSIYTPMC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |