C16H20N2O2 — CID 84757362
2-[bis(prop-2-enyl)amino]-2-(2,5-dimethoxyphenyl)acetonitrile (PubChem CID 84757362) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)amino]-2-(2,5-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-[bis(prop-2-enyl)amino]-2-(2,5-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 84757362 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-[bis(prop-2-enyl)amino]-2-(2,5-dimethoxyphenyl)acetonitrile |
| SMILES | C=CCN(CC=C)C(C#N)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H20N2O2/c1-5-9-18(10-6-2)15(12-17)14-11-13(19-3)7-8-16(14)20-4/h5-8,11,15H,1-2,9-10H2,3-4H3 |
| InChIKey | WKAVYCAREUYBOZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|