C16H26O4 — CID 116752634
1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-ol (PubChem CID 116752634) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 116752634 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-ethoxy-2-ethylbutan-1-ol |
| SMILES | CCOC(CC)(CC)C(O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H26O4/c1-6-16(7-2,20-8-3)15(17)13-11-12(18-4)9-10-14(13)19-5/h9-11,15,17H,6-8H2,1-5H3 |
| InChIKey | CRQIEPBYAAIASV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |