About tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate
tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103397856) has the molecular formula C11H21N3O2
and a molecular weight of 227.31 g/mol. Its IUPAC name is tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
Analyze tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The IUPAC name of tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate (CID 103397856) is tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate.
What is the SMILES notation for tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The canonical SMILES for tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate is CCNC1=NCCN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
The InChIKey is XBTRXWWAESSPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2/c1-5-12-9-8-14(7-6-13-9)10(15)16-11(2,3)4/h5-8H2,1-4H3,(H,12,13).
What are the key properties of tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate?
tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate has a molecular weight of 227.31 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-(ethylamino)-3,5-dihydro-2H-pyrazine-4-carboxylate is sourced from PubChem (CID 103397856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).