C14H28N4O2 — CID 103397890
tert-butyl 6-[3-(dimethylamino)propylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103397890) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl 6-[3-(dimethylamino)propylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[3-(dimethylamino)propylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103397890 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl 6-[3-(dimethylamino)propylamino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CN(C)CCCNC1=NCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N4O2/c1-14(2,3)20-13(19)18-10-8-16-12(11-18)15-7-6-9-17(4)5/h6-11H2,1-5H3,(H,15,16) |
| InChIKey | OTJCOLLFPWMFHN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|