C14H22N4O4 — CID 103398237
tert-butyl 6-[(2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103398237) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl 6-[(2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[(2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103398237 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | tert-butyl 6-[(2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(NC2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C14H22N4O4/c1-14(2,3)22-13(21)18-7-6-15-10(8-18)16-9-4-5-11(19)17-12(9)20/h9H,4-8H2,1-3H3,(H,15,16)(H,17,19,20) |
| InChIKey | QTCYDEPXYRUPAS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|