C15H24N4O4 — CID 103398238
tert-butyl 6-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate (PubChem CID 103398238) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 6-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate.
| Compound Name | tert-butyl 6-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
|---|---|
| PubChem CID | 103398238 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | tert-butyl 6-[(1-methyl-2,6-dioxopiperidin-3-yl)amino]-3,5-dihydro-2H-pyrazine-4-carboxylate |
| SMILES | CN1C(=O)CCC(NC2=NCCN(C(=O)OC(C)(C)C)C2)C1=O |
| InChI | InChI=1S/C15H24N4O4/c1-15(2,3)23-14(22)19-8-7-16-11(9-19)17-10-5-6-12(20)18(4)13(10)21/h10H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | AQOSYNVVHHKOSF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|