C12H25N5O2S — CID 103399113
N-[1-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide (PubChem CID 103399113) has the molecular formula C12H25N5O2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[1-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[1-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 103399113 |
| Molecular Formula | C12H25N5O2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[1-[(1-tert-butyltriazol-4-yl)methylamino]-2-methylpropan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNCc1cn(C(C)(C)C)nn1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H25N5O2S/c1-11(2,3)17-8-10(14-16-17)7-13-9-12(4,5)15-20(6,18)19/h8,13,15H,7,9H2,1-6H3 |
| InChIKey | FHBXXDNIGDBDLC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |