C17H16FN3O8 — CID 10341438
(2R,3S,4R,5R,6S)-2-[5-fluoro-2-(5-nitrofuran-2-yl)benzimidazol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10341438) has the molecular formula C17H16FN3O8 and a molecular weight of 409.33 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-[5-fluoro-2-(5-nitrofuran-2-yl)benzimidazol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-[5-fluoro-2-(5-nitrofuran-2-yl)benzimidazol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10341438 |
| Molecular Formula | C17H16FN3O8 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-[5-fluoro-2-(5-nitrofuran-2-yl)benzimidazol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3cc(F)ccc3n2[C@@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)o1 |
| InChI | InChI=1S/C17H16FN3O8/c18-7-1-2-9-8(5-7)19-16(10-3-4-12(28-10)21(26)27)20(9)17-15(25)14(24)13(23)11(6-22)29-17/h1-5,11,13-15,17,22-25H,6H2/t11-,13-,14+,15-,17+/m0/s1 |
| InChIKey | WOTSGGIUBKSMEP-FUAJKEFHSA-N |
| XLogP | 0.32 |
| TPSA | 164.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|