2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid

C16H13Br2NO3 — CID 10342440

IUPAC2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid
SMILESNC(Cc1ccc(C(=O)c2cc(Br)ccc2Br)cc1)C(=O)O
InChIInChI=1S/C16H13Br2NO3/c17-11-5-6-13(18)12(8-11)15(20)10-3-1-9(2-4-10)7-14(19)16(21)22/h1-6,8,14H,7,19H2,(H,21,22)
InChIKeyIKZAVBGLINDNHG-UHFFFAOYSA-N
MW427.09 g/mol
LogP3.40
Rot. Bonds5

About 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid

2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid (PubChem CID 10342440) has the molecular formula C16H13Br2NO3 and a molecular weight of 427.09 g/mol. Its IUPAC name is 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid.

Molecular Properties

Compound Name2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid
PubChem CID10342440
Molecular FormulaC16H13Br2NO3
Molecular Weight427.09 g/mol
Exact Mass424.93
IUPAC Name2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid
SMILESNC(Cc1ccc(C(=O)c2cc(Br)ccc2Br)cc1)C(=O)O
InChIInChI=1S/C16H13Br2NO3/c17-11-5-6-13(18)12(8-11)15(20)10-3-1-9(2-4-10)7-14(19)16(21)22/h1-6,8,14H,7,19H2,(H,21,22)
InChIKeyIKZAVBGLINDNHG-UHFFFAOYSA-N
XLogP3.40
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500427.09
LogP ≤ 53.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid?
The IUPAC name of 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid (CID 10342440) is 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid.
What is the SMILES notation for 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid?
The canonical SMILES for 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid is NC(Cc1ccc(C(=O)c2cc(Br)ccc2Br)cc1)C(=O)O.
What is the InChIKey of 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid?
The InChIKey is IKZAVBGLINDNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Br2NO3/c17-11-5-6-13(18)12(8-11)15(20)10-3-1-9(2-4-10)7-14(19)16(21)22/h1-6,8,14H,7,19H2,(H,21,22).
What are the key properties of 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid?
2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid has a molecular weight of 427.09 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[4-(2,5-dibromobenzoyl)phenyl]propanoic acid is sourced from PubChem (CID 10342440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).