C15H26N4OS — CID 103425750
3-amino-5-[5-(diethylamino)pentan-2-ylamino]-4-methoxythiophene-2-carbonitrile (PubChem CID 103425750) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 3-amino-5-[5-(diethylamino)pentan-2-ylamino]-4-methoxythiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[5-(diethylamino)pentan-2-ylamino]-4-methoxythiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103425750 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-amino-5-[5-(diethylamino)pentan-2-ylamino]-4-methoxythiophene-2-carbonitrile |
| SMILES | CCN(CC)CCCC(C)Nc1sc(C#N)c(N)c1OC |
| InChI | InChI=1S/C15H26N4OS/c1-5-19(6-2)9-7-8-11(3)18-15-14(20-4)13(17)12(10-16)21-15/h11,18H,5-9,17H2,1-4H3 |
| InChIKey | FSJXTDMNUGLNRR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 74.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |