C19H18F2N6OS2 — CID 10343639
2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-cyano-3-(2,6-difluorophenyl)guanidine (PubChem CID 10343639) has the molecular formula C19H18F2N6OS2 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-cyano-3-(2,6-difluorophenyl)guanidine.
| Compound Name | 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-cyano-3-(2,6-difluorophenyl)guanidine |
|---|---|
| PubChem CID | 10343639 |
| Molecular Formula | C19H18F2N6OS2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-cyano-3-(2,6-difluorophenyl)guanidine |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(/N=C(\NC#N)Nc3c(F)cccc3F)s2)o1 |
| InChI | InChI=1S/C19H18F2N6OS2/c1-19(2,3)13-7-23-14(28-13)9-29-15-8-24-18(30-15)27-17(25-10-22)26-16-11(20)5-4-6-12(16)21/h4-8H,9H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | ABKIVEMOQGQUJR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|