C8H11N5O3 — CID 103437129
4-(5-amino-1,3,4-oxadiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 103437129) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is 4-(5-amino-1,3,4-oxadiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(5-amino-1,3,4-oxadiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 103437129 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-(5-amino-1,3,4-oxadiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1nnc(N)o1 |
| InChI | InChI=1S/C8H11N5O3/c1-8(2)5(15)10-4(14)3-13(8)7-12-11-6(9)16-7/h3H2,1-2H3,(H2,9,11)(H,10,14,15) |
| InChIKey | RIXKNARXSFZZAF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|