C7H10O4S — CID 103439763
7,7-dioxo-1-oxa-7λ6-thiaspiro[4.4]nonan-2-one (PubChem CID 103439763) has the molecular formula C7H10O4S and a molecular weight of 190.22 g/mol. Its IUPAC name is 7,7-dioxo-1-oxa-7λ6-thiaspiro[4.4]nonan-2-one.
| Compound Name | 7,7-dioxo-1-oxa-7λ6-thiaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 103439763 |
| Molecular Formula | C7H10O4S |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 7,7-dioxo-1-oxa-7λ6-thiaspiro[4.4]nonan-2-one |
| SMILES | O=C1CCC2(CCS(=O)(=O)C2)O1 |
| InChI | InChI=1S/C7H10O4S/c8-6-1-2-7(11-6)3-4-12(9,10)5-7/h1-5H2 |
| InChIKey | HCPODMSDFNGXFZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |