C8H12O4S — CID 103439894
8,8-dioxo-1-oxa-8λ6-thiaspiro[4.5]decan-2-one (PubChem CID 103439894) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 8,8-dioxo-1-oxa-8λ6-thiaspiro[4.5]decan-2-one.
| Compound Name | 8,8-dioxo-1-oxa-8λ6-thiaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 103439894 |
| Molecular Formula | C8H12O4S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 8,8-dioxo-1-oxa-8λ6-thiaspiro[4.5]decan-2-one |
| SMILES | O=C1CCC2(CCS(=O)(=O)CC2)O1 |
| InChI | InChI=1S/C8H12O4S/c9-7-1-2-8(12-7)3-5-13(10,11)6-4-8/h1-6H2 |
| InChIKey | CWHLYQVTIIWKTQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |