C11H18O4S — CID 95974367
[(3S)-1,1-dioxothian-3-yl] cyclopentanecarboxylate (PubChem CID 95974367) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is [(3S)-1,1-dioxothian-3-yl] cyclopentanecarboxylate.
| Compound Name | [(3S)-1,1-dioxothian-3-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 95974367 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [(3S)-1,1-dioxothian-3-yl] cyclopentanecarboxylate |
| SMILES | O=C(O[C@H]1CCCS(=O)(=O)C1)C1CCCC1 |
| InChI | InChI=1S/C11H18O4S/c12-11(9-4-1-2-5-9)15-10-6-3-7-16(13,14)8-10/h9-10H,1-8H2/t10-/m0/s1 |
| InChIKey | PNSVNDMAGCJOIA-JTQLQIEISA-N |
| XLogP | 1.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |