C18H25F7O5S — CID 163579471
[1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,4,4,4-heptafluorobutoxy)propan-2-yl] cyclopentanecarboxylate (PubChem CID 163579471) has the molecular formula C18H25F7O5S and a molecular weight of 486.45 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,4,4,4-heptafluorobutoxy)propan-2-yl] cyclopentanecarboxylate.
| Compound Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,4,4,4-heptafluorobutoxy)propan-2-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 163579471 |
| Molecular Formula | C18H25F7O5S |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)-3-(1,1,2,2,4,4,4-heptafluorobutoxy)propan-2-yl] cyclopentanecarboxylate |
| SMILES | O=C(OC(COC(F)(F)C(F)(F)CC(F)(F)F)CC1CCS(=O)(=O)CC1)C1CCCC1 |
| InChI | InChI=1S/C18H25F7O5S/c19-16(20,11-17(21,22)23)18(24,25)29-10-14(30-15(26)13-3-1-2-4-13)9-12-5-7-31(27,28)8-6-12/h12-14H,1-11H2 |
| InChIKey | LJEYVMYEBOMQFN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|