C8H14O5S — CID 84735376
methyl 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoate (PubChem CID 84735376) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoate |
|---|---|
| PubChem CID | 84735376 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | methyl 3-(3-hydroxy-1,1-dioxothiolan-3-yl)propanoate |
| SMILES | COC(=O)CCC1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O5S/c1-13-7(9)2-3-8(10)4-5-14(11,12)6-8/h10H,2-6H2,1H3 |
| InChIKey | VHEXMZBQMDUTSR-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |