C11H15ClN2 — CID 103444341
1-(3-chloro-2-pyridinyl)-N-methylpent-4-en-1-amine (PubChem CID 103444341) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-methylpent-4-en-1-amine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 103444341 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-methylpent-4-en-1-amine |
| SMILES | C=CCCC(NC)c1ncccc1Cl |
| InChI | InChI=1S/C11H15ClN2/c1-3-4-7-10(13-2)11-9(12)6-5-8-14-11/h3,5-6,8,10,13H,1,4,7H2,2H3 |
| InChIKey | YGXKOEYOMNZIDO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|