C13H15BrOS — CID 103451073
2-(5-bromothiophen-2-yl)-1-(4-methylcyclohexen-1-yl)ethanone (PubChem CID 103451073) has the molecular formula C13H15BrOS and a molecular weight of 299.23 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-1-(4-methylcyclohexen-1-yl)ethanone.
| Compound Name | 2-(5-bromothiophen-2-yl)-1-(4-methylcyclohexen-1-yl)ethanone |
|---|---|
| PubChem CID | 103451073 |
| Molecular Formula | C13H15BrOS |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-1-(4-methylcyclohexen-1-yl)ethanone |
| SMILES | CC1CC=C(C(=O)Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C13H15BrOS/c1-9-2-4-10(5-3-9)12(15)8-11-6-7-13(14)16-11/h4,6-7,9H,2-3,5,8H2,1H3 |
| InChIKey | YTUXXHMAYRYYIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |