C25H22N2O9 — CID 10345620
ethyl 5-benzamido-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-6-oxopyran-3-carboxylate (PubChem CID 10345620) has the molecular formula C25H22N2O9 and a molecular weight of 494.46 g/mol. Its IUPAC name is ethyl 5-benzamido-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-6-oxopyran-3-carboxylate.
| Compound Name | ethyl 5-benzamido-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-6-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 10345620 |
| Molecular Formula | C25H22N2O9 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | ethyl 5-benzamido-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]-6-oxopyran-3-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccccc2)c(=O)oc1/C=C/c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22N2O9/c1-4-35-24(29)17-13-18(26-23(28)15-8-6-5-7-9-15)25(30)36-20(17)11-10-16-12-21(33-2)22(34-3)14-19(16)27(31)32/h5-14H,4H2,1-3H3,(H,26,28)/b11-10+ |
| InChIKey | ZLNUTBWCGCFLOE-ZHACJKMWSA-N |
| XLogP | 4.16 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|