C23H30N2O7Si — CID 164580225
2-trimethylsilylethyl 5-(3-benzamidopropoxy)-4-methoxy-2-nitrobenzoate (PubChem CID 164580225) has the molecular formula C23H30N2O7Si and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-(3-benzamidopropoxy)-4-methoxy-2-nitrobenzoate.
| Compound Name | 2-trimethylsilylethyl 5-(3-benzamidopropoxy)-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 164580225 |
| Molecular Formula | C23H30N2O7Si |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-trimethylsilylethyl 5-(3-benzamidopropoxy)-4-methoxy-2-nitrobenzoate |
| SMILES | COc1cc([N+](=O)[O-])c(C(=O)OCC[Si](C)(C)C)cc1OCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O7Si/c1-30-20-16-19(25(28)29)18(23(27)32-13-14-33(2,3)4)15-21(20)31-12-8-11-24-22(26)17-9-6-5-7-10-17/h5-7,9-10,15-16H,8,11-14H2,1-4H3,(H,24,26) |
| InChIKey | LDPFZPUEPWKMMN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|