C15H25NO3S — CID 103458009
1-cyclohexylidene-3-(1-methylsulfonylpiperidin-3-yl)propan-2-one (PubChem CID 103458009) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-cyclohexylidene-3-(1-methylsulfonylpiperidin-3-yl)propan-2-one.
| Compound Name | 1-cyclohexylidene-3-(1-methylsulfonylpiperidin-3-yl)propan-2-one |
|---|---|
| PubChem CID | 103458009 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-cyclohexylidene-3-(1-methylsulfonylpiperidin-3-yl)propan-2-one |
| SMILES | CS(=O)(=O)N1CCCC(CC(=O)C=C2CCCCC2)C1 |
| InChI | InChI=1S/C15H25NO3S/c1-20(18,19)16-9-5-8-14(12-16)11-15(17)10-13-6-3-2-4-7-13/h10,14H,2-9,11-12H2,1H3 |
| InChIKey | ZHJCHLUMKMKEQA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|