C11H13F4NO3S — CID 103473431
4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 103473431) has the molecular formula C11H13F4NO3S and a molecular weight of 315.29 g/mol. Its IUPAC name is 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103473431 |
| Molecular Formula | C11H13F4NO3S |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-propyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCc1nc(COCC(F)(F)C(F)F)sc1C(=O)O |
| InChI | InChI=1S/C11H13F4NO3S/c1-2-3-6-8(9(17)18)20-7(16-6)4-19-5-11(14,15)10(12)13/h10H,2-5H2,1H3,(H,17,18) |
| InChIKey | FBKVBYMLCVYUQA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|