C11H18F4O2 — CID 103473638
4-ethyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-one (PubChem CID 103473638) has the molecular formula C11H18F4O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-ethyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-one.
| Compound Name | 4-ethyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-one |
|---|---|
| PubChem CID | 103473638 |
| Molecular Formula | C11H18F4O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-ethyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-one |
| SMILES | CCC(CC)CC(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H18F4O2/c1-3-8(4-2)5-9(16)6-17-7-11(14,15)10(12)13/h8,10H,3-7H2,1-2H3 |
| InChIKey | FBUCFXXJTRALEN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|