C10H19N3O — CID 103482318
2-[2-(3,4,5-trimethylpyrazol-1-yl)ethoxy]ethanamine (PubChem CID 103482318) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[2-(3,4,5-trimethylpyrazol-1-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(3,4,5-trimethylpyrazol-1-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 103482318 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-[2-(3,4,5-trimethylpyrazol-1-yl)ethoxy]ethanamine |
| SMILES | Cc1nn(CCOCCN)c(C)c1C |
| InChI | InChI=1S/C10H19N3O/c1-8-9(2)12-13(10(8)3)5-7-14-6-4-11/h4-7,11H2,1-3H3 |
| InChIKey | GVQIQKOTYFMPEC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|