About 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate
1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate (PubChem CID 103489106) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate.
Molecular Properties
| Compound Name | 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate |
| PubChem CID | 103489106 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate |
| SMILES | CCOCC(C)OC(=O)c1ccc(NCCO)cc1 |
| InChI | InChI=1S/C14H21NO4/c1-3-18-10-11(2)19-14(17)12-4-6-13(7-5-12)15-8-9-16/h4-7,11,15-16H,3,8-10H2,1-2H3 |
| InChIKey | WZQAZBKPVWKMPU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate?
The IUPAC name of 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate (CID 103489106) is 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate.
What is the SMILES notation for 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate?
The canonical SMILES for 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate is CCOCC(C)OC(=O)c1ccc(NCCO)cc1.
What is the InChIKey of 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate?
The InChIKey is WZQAZBKPVWKMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-3-18-10-11(2)19-14(17)12-4-6-13(7-5-12)15-8-9-16/h4-7,11,15-16H,3,8-10H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate?
1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate has a molecular weight of 267.32 g/mol, XLogP of 1.67, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 4-(2-hydroxyethylamino)benzoate is sourced from PubChem (CID 103489106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).