C16H23FN2O — CID 103497243
6-fluoro-1-(3-piperidin-4-yloxypropyl)-2,3-dihydroindole (PubChem CID 103497243) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 6-fluoro-1-(3-piperidin-4-yloxypropyl)-2,3-dihydroindole.
| Compound Name | 6-fluoro-1-(3-piperidin-4-yloxypropyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 103497243 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 6-fluoro-1-(3-piperidin-4-yloxypropyl)-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(CCCOC1CCNCC1)CC2 |
| InChI | InChI=1S/C16H23FN2O/c17-14-3-2-13-6-10-19(16(13)12-14)9-1-11-20-15-4-7-18-8-5-15/h2-3,12,15,18H,1,4-11H2 |
| InChIKey | PYORFSSYUIUWCW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|