C15H20N4S — CID 103505429
5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-cyclopropylthiophene-2-carbonitrile (PubChem CID 103505429) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-cyclopropylthiophene-2-carbonitrile.
| Compound Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-cyclopropylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103505429 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-amino-4-cyclopropylthiophene-2-carbonitrile |
| SMILES | N#Cc1sc(N2CCN3CCCC3C2)c(C2CC2)c1N |
| InChI | InChI=1S/C15H20N4S/c16-8-12-14(17)13(10-3-4-10)15(20-12)19-7-6-18-5-1-2-11(18)9-19/h10-11H,1-7,9,17H2 |
| InChIKey | DTESAURZZZYYLS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |