About 4-methoxypentanoyl isocyanate
4-methoxypentanoyl isocyanate (PubChem CID 103513057) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-methoxypentanoyl isocyanate.
Molecular Properties
| Compound Name | 4-methoxypentanoyl isocyanate |
| PubChem CID | 103513057 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-methoxypentanoyl isocyanate |
| SMILES | COC(C)CCC(=O)N=C=O |
| InChI | InChI=1S/C7H11NO3/c1-6(11-2)3-4-7(10)8-5-9/h6H,3-4H2,1-2H3 |
| InChIKey | GSXPNWXQOXWOKS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxypentanoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypentanoyl isocyanate?
The IUPAC name of 4-methoxypentanoyl isocyanate (CID 103513057) is 4-methoxypentanoyl isocyanate.
What is the SMILES notation for 4-methoxypentanoyl isocyanate?
The canonical SMILES for 4-methoxypentanoyl isocyanate is COC(C)CCC(=O)N=C=O.
What is the InChIKey of 4-methoxypentanoyl isocyanate?
The InChIKey is GSXPNWXQOXWOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-6(11-2)3-4-7(10)8-5-9/h6H,3-4H2,1-2H3.
What are the key properties of 4-methoxypentanoyl isocyanate?
4-methoxypentanoyl isocyanate has a molecular weight of 157.17 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypentanoyl isocyanate is sourced from PubChem (CID 103513057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).