About 5-oxopentanoyl isocyanate
5-oxopentanoyl isocyanate (PubChem CID 175270373) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 5-oxopentanoyl isocyanate.
Molecular Properties
| Compound Name | 5-oxopentanoyl isocyanate |
| PubChem CID | 175270373 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 5-oxopentanoyl isocyanate |
| SMILES | O=C=NC(=O)CCCC=O |
| InChI | InChI=1S/C6H7NO3/c8-4-2-1-3-6(10)7-5-9/h4H,1-3H2 |
| InChIKey | MSHKYWAFJPEWTI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-oxopentanoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxopentanoyl isocyanate?
The IUPAC name of 5-oxopentanoyl isocyanate (CID 175270373) is 5-oxopentanoyl isocyanate.
What is the SMILES notation for 5-oxopentanoyl isocyanate?
The canonical SMILES for 5-oxopentanoyl isocyanate is O=C=NC(=O)CCCC=O.
What is the InChIKey of 5-oxopentanoyl isocyanate?
The InChIKey is MSHKYWAFJPEWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-4-2-1-3-6(10)7-5-9/h4H,1-3H2.
What are the key properties of 5-oxopentanoyl isocyanate?
5-oxopentanoyl isocyanate has a molecular weight of 141.13 g/mol, XLogP of 0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxopentanoyl isocyanate is sourced from PubChem (CID 175270373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).