About 8-oxooctanoyl isocyanate
8-oxooctanoyl isocyanate (PubChem CID 175108749) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 8-oxooctanoyl isocyanate.
Molecular Properties
| Compound Name | 8-oxooctanoyl isocyanate |
| PubChem CID | 175108749 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 8-oxooctanoyl isocyanate |
| SMILES | O=C=NC(=O)CCCCCCC=O |
| InChI | InChI=1S/C9H13NO3/c11-7-5-3-1-2-4-6-9(13)10-8-12/h7H,1-6H2 |
| InChIKey | CHGSDSJMJVITIZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 8-oxooctanoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxooctanoyl isocyanate?
The IUPAC name of 8-oxooctanoyl isocyanate (CID 175108749) is 8-oxooctanoyl isocyanate.
What is the SMILES notation for 8-oxooctanoyl isocyanate?
The canonical SMILES for 8-oxooctanoyl isocyanate is O=C=NC(=O)CCCCCCC=O.
What is the InChIKey of 8-oxooctanoyl isocyanate?
The InChIKey is CHGSDSJMJVITIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c11-7-5-3-1-2-4-6-9(13)10-8-12/h7H,1-6H2.
What are the key properties of 8-oxooctanoyl isocyanate?
8-oxooctanoyl isocyanate has a molecular weight of 183.21 g/mol, XLogP of 1.39, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxooctanoyl isocyanate is sourced from PubChem (CID 175108749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).