About 18-oxooctadecanoyl iodide
18-oxooctadecanoyl iodide (PubChem CID 88943662) has the molecular formula C18H33IO2
and a molecular weight of 408.36 g/mol. Its IUPAC name is 18-oxooctadecanoyl iodide.
Molecular Properties
| Compound Name | 18-oxooctadecanoyl iodide |
| PubChem CID | 88943662 |
| Molecular Formula | C18H33IO2 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 18-oxooctadecanoyl iodide |
| SMILES | O=CCCCCCCCCCCCCCCCCC(=O)I |
| InChI | InChI=1S/C18H33IO2/c19-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-20/h17H,1-16H2 |
| InChIKey | DJXJJYFFSIEKGP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 18-oxooctadecanoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-oxooctadecanoyl iodide?
The IUPAC name of 18-oxooctadecanoyl iodide (CID 88943662) is 18-oxooctadecanoyl iodide.
What is the SMILES notation for 18-oxooctadecanoyl iodide?
The canonical SMILES for 18-oxooctadecanoyl iodide is O=CCCCCCCCCCCCCCCCCC(=O)I.
What is the InChIKey of 18-oxooctadecanoyl iodide?
The InChIKey is DJXJJYFFSIEKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33IO2/c19-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-20/h17H,1-16H2.
What are the key properties of 18-oxooctadecanoyl iodide?
18-oxooctadecanoyl iodide has a molecular weight of 408.36 g/mol, XLogP of 6.39, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 18-oxooctadecanoyl iodide is sourced from PubChem (CID 88943662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).