About 4,5-dioxoheptadecanedial
4,5-dioxoheptadecanedial (PubChem CID 172835159) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is 4,5-dioxoheptadecanedial.
Molecular Properties
| Compound Name | 4,5-dioxoheptadecanedial |
| PubChem CID | 172835159 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4,5-dioxoheptadecanedial |
| SMILES | O=CCCCCCCCCCCCC(=O)C(=O)CCC=O |
| InChI | InChI=1S/C17H28O4/c18-14-10-8-6-4-2-1-3-5-7-9-12-16(20)17(21)13-11-15-19/h14-15H,1-13H2 |
| InChIKey | WAYUPVUHJCQSJO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dioxoheptadecanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dioxoheptadecanedial?
The IUPAC name of 4,5-dioxoheptadecanedial (CID 172835159) is 4,5-dioxoheptadecanedial.
What is the SMILES notation for 4,5-dioxoheptadecanedial?
The canonical SMILES for 4,5-dioxoheptadecanedial is O=CCCCCCCCCCCCC(=O)C(=O)CCC=O.
What is the InChIKey of 4,5-dioxoheptadecanedial?
The InChIKey is WAYUPVUHJCQSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O4/c18-14-10-8-6-4-2-1-3-5-7-9-12-16(20)17(21)13-11-15-19/h14-15H,1-13H2.
What are the key properties of 4,5-dioxoheptadecanedial?
4,5-dioxoheptadecanedial has a molecular weight of 296.41 g/mol, XLogP of 3.59, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dioxoheptadecanedial is sourced from PubChem (CID 172835159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).