About 9-oxononanoate
9-oxononanoate (PubChem CID 21270557) has the molecular formula C9H15O3-
and a molecular weight of 171.22 g/mol. Its IUPAC name is 9-oxononanoate.
Molecular Properties
| Compound Name | 9-oxononanoate |
| PubChem CID | 21270557 |
| Molecular Formula | C9H15O3- |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 9-oxononanoate |
| SMILES | O=CCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C9H16O3/c10-8-6-4-2-1-3-5-7-9(11)12/h8H,1-7H2,(H,11,12)/p-1 |
| InChIKey | WLGDDELKYAWBBL-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-oxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-oxononanoate?
The IUPAC name of 9-oxononanoate (CID 21270557) is 9-oxononanoate.
What is the SMILES notation for 9-oxononanoate?
The canonical SMILES for 9-oxononanoate is O=CCCCCCCCC(=O)[O-].
What is the InChIKey of 9-oxononanoate?
The InChIKey is WLGDDELKYAWBBL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H16O3/c10-8-6-4-2-1-3-5-7-9(11)12/h8H,1-7H2,(H,11,12)/p-1.
What are the key properties of 9-oxononanoate?
9-oxononanoate has a molecular weight of 171.22 g/mol, XLogP of 0.67, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-oxononanoate is sourced from PubChem (CID 21270557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).