About copper bis(6-oxohexanoate)
copper bis(6-oxohexanoate) (PubChem CID 88811227) has the molecular formula C12H18CuO6
and a molecular weight of 321.82 g/mol. Its IUPAC name is copper bis(6-oxohexanoate).
Molecular Properties
| Compound Name | copper bis(6-oxohexanoate) |
| PubChem CID | 88811227 |
| Molecular Formula | C12H18CuO6 |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | copper bis(6-oxohexanoate) |
| SMILES | O=CCCCCC(=O)[O-].O=CCCCCC(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C6H10O3.Cu/c2*7-5-3-1-2-4-6(8)9;/h2*5H,1-4H2,(H,8,9);/q;;+2/p-2 |
| InChIKey | ADTRHBUSNCDNMZ-UHFFFAOYSA-L |
| XLogP | -1.01 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze copper bis(6-oxohexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(6-oxohexanoate)?
The IUPAC name of copper bis(6-oxohexanoate) (CID 88811227) is copper bis(6-oxohexanoate).
What is the SMILES notation for copper bis(6-oxohexanoate)?
The canonical SMILES for copper bis(6-oxohexanoate) is O=CCCCCC(=O)[O-].O=CCCCCC(=O)[O-].[Cu+2].
What is the InChIKey of copper bis(6-oxohexanoate)?
The InChIKey is ADTRHBUSNCDNMZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H10O3.Cu/c2*7-5-3-1-2-4-6(8)9;/h2*5H,1-4H2,(H,8,9);/q;;+2/p-2.
What are the key properties of copper bis(6-oxohexanoate)?
copper bis(6-oxohexanoate) has a molecular weight of 321.82 g/mol, XLogP of -1.01, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(6-oxohexanoate) is sourced from PubChem (CID 88811227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).