About (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate
(2S)-2-(ditert-butylamino)pentanedioyl diisocyanate (PubChem CID 87856942) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate.
Molecular Properties
| Compound Name | (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate |
| PubChem CID | 87856942 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate |
| SMILES | CC(C)(C)N([C@@H](CCC(=O)N=C=O)C(=O)N=C=O)C(C)(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-14(2,3)18(15(4,5)6)11(13(22)17-10-20)7-8-12(21)16-9-19/h11H,7-8H2,1-6H3/t11-/m0/s1 |
| InChIKey | XXSDXFQBQHIALU-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate?
The IUPAC name of (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate (CID 87856942) is (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate.
What is the SMILES notation for (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate?
The canonical SMILES for (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate is CC(C)(C)N([C@@H](CCC(=O)N=C=O)C(=O)N=C=O)C(C)(C)C.
What is the InChIKey of (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate?
The InChIKey is XXSDXFQBQHIALU-NSHDSACASA-N. The full InChI is InChI=1S/C15H23N3O4/c1-14(2,3)18(15(4,5)6)11(13(22)17-10-20)7-8-12(21)16-9-19/h11H,7-8H2,1-6H3/t11-/m0/s1.
What are the key properties of (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate?
(2S)-2-(ditert-butylamino)pentanedioyl diisocyanate has a molecular weight of 309.37 g/mol, XLogP of 1.76, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(ditert-butylamino)pentanedioyl diisocyanate is sourced from PubChem (CID 87856942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).