C14H10ClF2N — CID 103514419
3-(1-chloro-2,2-difluoroethyl)-9H-carbazole (PubChem CID 103514419) has the molecular formula C14H10ClF2N and a molecular weight of 265.69 g/mol. Its IUPAC name is 3-(1-chloro-2,2-difluoroethyl)-9H-carbazole.
| Compound Name | 3-(1-chloro-2,2-difluoroethyl)-9H-carbazole |
|---|---|
| PubChem CID | 103514419 |
| Molecular Formula | C14H10ClF2N |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-(1-chloro-2,2-difluoroethyl)-9H-carbazole |
| SMILES | FC(F)C(Cl)c1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C14H10ClF2N/c15-13(14(16)17)8-5-6-12-10(7-8)9-3-1-2-4-11(9)18-12/h1-7,13-14,18H |
| InChIKey | KTJGKZMDTYZQPD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|