C8H10F2N2OS — CID 103515656
2,2-difluoro-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 103515656) has the molecular formula C8H10F2N2OS and a molecular weight of 220.24 g/mol. Its IUPAC name is 2,2-difluoro-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 103515656 |
| Molecular Formula | C8H10F2N2OS |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2,2-difluoro-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(C)c1csc(NC(=O)C(F)F)n1 |
| InChI | InChI=1S/C8H10F2N2OS/c1-4(2)5-3-14-8(11-5)12-7(13)6(9)10/h3-4,6H,1-2H3,(H,11,12,13) |
| InChIKey | BSAQCMWDMWHJEW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |