C9H19F2N — CID 103517025
1,1-difluoro-N,6-dimethylheptan-2-amine (PubChem CID 103517025) has the molecular formula C9H19F2N and a molecular weight of 179.25 g/mol. Its IUPAC name is 1,1-difluoro-N,6-dimethylheptan-2-amine.
| Compound Name | 1,1-difluoro-N,6-dimethylheptan-2-amine |
|---|---|
| PubChem CID | 103517025 |
| Molecular Formula | C9H19F2N |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 1,1-difluoro-N,6-dimethylheptan-2-amine |
| SMILES | CNC(CCCC(C)C)C(F)F |
| InChI | InChI=1S/C9H19F2N/c1-7(2)5-4-6-8(12-3)9(10)11/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | DVJGKTRXOSPZBD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |