C10H12BrN3 — CID 103518477
5-bromo-4-N-cyclopent-3-en-1-ylpyridine-3,4-diamine (PubChem CID 103518477) has the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. Its IUPAC name is 5-bromo-4-N-cyclopent-3-en-1-ylpyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-cyclopent-3-en-1-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518477 |
| Molecular Formula | C10H12BrN3 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-bromo-4-N-cyclopent-3-en-1-ylpyridine-3,4-diamine |
| SMILES | Nc1cncc(Br)c1NC1CC=CC1 |
| InChI | InChI=1S/C10H12BrN3/c11-8-5-13-6-9(12)10(8)14-7-3-1-2-4-7/h1-2,5-7H,3-4,12H2,(H,13,14) |
| InChIKey | AGAWEZHWUWLNJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|