C10H14BrN3OS — CID 103518484
5-bromo-4-N-(1-oxothian-4-yl)pyridine-3,4-diamine (PubChem CID 103518484) has the molecular formula C10H14BrN3OS and a molecular weight of 304.21 g/mol. Its IUPAC name is 5-bromo-4-N-(1-oxothian-4-yl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(1-oxothian-4-yl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518484 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 5-bromo-4-N-(1-oxothian-4-yl)pyridine-3,4-diamine |
| SMILES | Nc1cncc(Br)c1NC1CCS(=O)CC1 |
| InChI | InChI=1S/C10H14BrN3OS/c11-8-5-13-6-9(12)10(8)14-7-1-3-16(15)4-2-7/h5-7H,1-4,12H2,(H,13,14) |
| InChIKey | JJEITMPIFCEATM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |