C13H20BrN3 — CID 103518309
5-bromo-4-N-(2,2-dimethylcyclohexyl)pyridine-3,4-diamine (PubChem CID 103518309) has the molecular formula C13H20BrN3 and a molecular weight of 298.23 g/mol. Its IUPAC name is 5-bromo-4-N-(2,2-dimethylcyclohexyl)pyridine-3,4-diamine.
| Compound Name | 5-bromo-4-N-(2,2-dimethylcyclohexyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 103518309 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-bromo-4-N-(2,2-dimethylcyclohexyl)pyridine-3,4-diamine |
| SMILES | CC1(C)CCCCC1Nc1c(N)cncc1Br |
| InChI | InChI=1S/C13H20BrN3/c1-13(2)6-4-3-5-11(13)17-12-9(14)7-16-8-10(12)15/h7-8,11H,3-6,15H2,1-2H3,(H,16,17) |
| InChIKey | GKWWAXAAAXSBMQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |