C12H19N3 — CID 104535281
5-N-(2,2-dimethylcyclopentyl)pyridine-3,5-diamine (PubChem CID 104535281) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 5-N-(2,2-dimethylcyclopentyl)pyridine-3,5-diamine.
| Compound Name | 5-N-(2,2-dimethylcyclopentyl)pyridine-3,5-diamine |
|---|---|
| PubChem CID | 104535281 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 5-N-(2,2-dimethylcyclopentyl)pyridine-3,5-diamine |
| SMILES | CC1(C)CCCC1Nc1cncc(N)c1 |
| InChI | InChI=1S/C12H19N3/c1-12(2)5-3-4-11(12)15-10-6-9(13)7-14-8-10/h6-8,11,15H,3-5,13H2,1-2H3 |
| InChIKey | QSZQBEIPJCAJBL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |