C7H11ClO2 — CID 10352008
(2S,3R,4R)-2-chloro-3-hydroxy-4-methylcyclohexan-1-one (PubChem CID 10352008) has the molecular formula C7H11ClO2 and a molecular weight of 162.62 g/mol. Its IUPAC name is (2S,3R,4R)-2-chloro-3-hydroxy-4-methylcyclohexan-1-one.
| Compound Name | (2S,3R,4R)-2-chloro-3-hydroxy-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 10352008 |
| Molecular Formula | C7H11ClO2 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (2S,3R,4R)-2-chloro-3-hydroxy-4-methylcyclohexan-1-one |
| SMILES | C[C@@H]1CCC(=O)[C@@H](Cl)[C@@H]1O |
| InChI | InChI=1S/C7H11ClO2/c1-4-2-3-5(9)6(8)7(4)10/h4,6-7,10H,2-3H2,1H3/t4-,6-,7-/m1/s1 |
| InChIKey | IAKUUKSJXVDVRE-QPPQHZFASA-N |
| XLogP | 0.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|