C6H10FNO3 — CID 10352013
(3S,4R,5R)-6-(fluoromethyl)-2,3,4,5-tetrahydropyridine-3,4,5-triol (PubChem CID 10352013) has the molecular formula C6H10FNO3 and a molecular weight of 163.15 g/mol. Its IUPAC name is (3S,4R,5R)-6-(fluoromethyl)-2,3,4,5-tetrahydropyridine-3,4,5-triol.
| Compound Name | (3S,4R,5R)-6-(fluoromethyl)-2,3,4,5-tetrahydropyridine-3,4,5-triol |
|---|---|
| PubChem CID | 10352013 |
| Molecular Formula | C6H10FNO3 |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3S,4R,5R)-6-(fluoromethyl)-2,3,4,5-tetrahydropyridine-3,4,5-triol |
| SMILES | O[C@H]1[C@H](O)C(CF)=NC[C@@H]1O |
| InChI | InChI=1S/C6H10FNO3/c7-1-3-5(10)6(11)4(9)2-8-3/h4-6,9-11H,1-2H2/t4-,5+,6+/m0/s1 |
| InChIKey | KXFHZEDCVCDORH-KVQBGUIXSA-N |
| XLogP | -1.51 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |