C6H11NO5 — CID 140745514
(3R,4S,5R)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridine-2,3,4,5-tetrol (PubChem CID 140745514) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (3R,4S,5R)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridine-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5R)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridine-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140745514 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (3R,4S,5R)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridine-2,3,4,5-tetrol |
| SMILES | OCC1=NC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h3-6,8-12H,1H2/t3-,4+,5-,6?/m1/s1 |
| InChIKey | AOKJYAODGFPUQL-IANNHFEVSA-N |
| XLogP | -3.17 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |