C12H25NO4 — CID 87433785
(3R,4R,5S)-2-hexyliminohexane-1,3,4,5-tetrol (PubChem CID 87433785) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is (3R,4R,5S)-2-hexyliminohexane-1,3,4,5-tetrol.
| Compound Name | (3R,4R,5S)-2-hexyliminohexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 87433785 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (3R,4R,5S)-2-hexyliminohexane-1,3,4,5-tetrol |
| SMILES | CCCCCC/N=C(\CO)[C@@H](O)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C12H25NO4/c1-3-4-5-6-7-13-10(8-14)12(17)11(16)9(2)15/h9,11-12,14-17H,3-8H2,1-2H3/b13-10+/t9-,11+,12+/m0/s1 |
| InChIKey | BHQRIPNVIOIWCJ-FDCPMHENSA-N |
| XLogP | 0.10 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|