C11H23NO4 — CID 170858132
(2R,3S,4R,5S)-1-pentyliminohexane-2,3,4,5-tetrol (PubChem CID 170858132) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1-pentyliminohexane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-1-pentyliminohexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 170858132 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (2R,3S,4R,5S)-1-pentyliminohexane-2,3,4,5-tetrol |
| SMILES | CCCCC/N=C/[C@@H](O)[C@H](O)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C11H23NO4/c1-3-4-5-6-12-7-9(14)11(16)10(15)8(2)13/h7-11,13-16H,3-6H2,1-2H3/b12-7+/t8-,9+,10+,11-/m0/s1 |
| InChIKey | XHLCTZWOHRJHLL-KOUMMCQUSA-N |
| XLogP | -0.29 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|